C22H32N2O2S — CID 20957554
2,5-dimethyl-1-[(3-methylphenyl)methyl]-4-[(3-propylsulfanylpropylamino)methyl]pyrrole-3-carboxylic acid (PubChem CID 20957554) has the molecular formula C22H32N2O2S and a molecular weight of 388.58 g/mol. Its IUPAC name is 2,5-dimethyl-1-[(3-methylphenyl)methyl]-4-[(3-propylsulfanylpropylamino)methyl]pyrrole-3-carboxylic acid.
| Compound Name | 2,5-dimethyl-1-[(3-methylphenyl)methyl]-4-[(3-propylsulfanylpropylamino)methyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 20957554 |
| Molecular Formula | C22H32N2O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2,5-dimethyl-1-[(3-methylphenyl)methyl]-4-[(3-propylsulfanylpropylamino)methyl]pyrrole-3-carboxylic acid |
| SMILES | CCCSCCCNCc1c(C(=O)O)c(C)n(Cc2cccc(C)c2)c1C |
| InChI | InChI=1S/C22H32N2O2S/c1-5-11-27-12-7-10-23-14-20-17(3)24(18(4)21(20)22(25)26)15-19-9-6-8-16(2)13-19/h6,8-9,13,23H,5,7,10-12,14-15H2,1-4H3,(H,25,26) |
| InChIKey | CKJJVFZORLBFNV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|