C22H26N2O3S — CID 20957825
1-[(3-methoxyphenyl)methyl]-2,5-dimethyl-4-[(2-thiophen-2-ylethylamino)methyl]pyrrole-3-carboxylic acid (PubChem CID 20957825) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-2,5-dimethyl-4-[(2-thiophen-2-ylethylamino)methyl]pyrrole-3-carboxylic acid.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-2,5-dimethyl-4-[(2-thiophen-2-ylethylamino)methyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 20957825 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-2,5-dimethyl-4-[(2-thiophen-2-ylethylamino)methyl]pyrrole-3-carboxylic acid |
| SMILES | COc1cccc(Cn2c(C)c(CNCCc3cccs3)c(C(=O)O)c2C)c1 |
| InChI | InChI=1S/C22H26N2O3S/c1-15-20(13-23-10-9-19-8-5-11-28-19)21(22(25)26)16(2)24(15)14-17-6-4-7-18(12-17)27-3/h4-8,11-12,23H,9-10,13-14H2,1-3H3,(H,25,26) |
| InChIKey | WSJUJCQCVFKNOB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|