C26H36N6O2 — CID 20891901
2-(5-methyl-4-oxopyridazino[4,5-b]indol-3-yl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]acetamide (PubChem CID 20891901) has the molecular formula C26H36N6O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-(5-methyl-4-oxopyridazino[4,5-b]indol-3-yl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-(5-methyl-4-oxopyridazino[4,5-b]indol-3-yl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 20891901 |
| Molecular Formula | C26H36N6O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 2-(5-methyl-4-oxopyridazino[4,5-b]indol-3-yl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]acetamide |
| SMILES | Cn1c2ccccc2c2cnn(CC(=O)NCCCN3CCC(N4CCCCC4)CC3)c(=O)c21 |
| InChI | InChI=1S/C26H36N6O2/c1-29-23-9-4-3-8-21(23)22-18-28-32(26(34)25(22)29)19-24(33)27-12-7-13-30-16-10-20(11-17-30)31-14-5-2-6-15-31/h3-4,8-9,18,20H,2,5-7,10-17,19H2,1H3,(H,27,33) |
| InChIKey | NOADMIUXIRSBQK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|