C17H23N5O2 — CID 35410706
2-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(3-piperidin-1-ylpropyl)acetamide (PubChem CID 35410706) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(3-piperidin-1-ylpropyl)acetamide.
| Compound Name | 2-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(3-piperidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 35410706 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(3-piperidin-1-ylpropyl)acetamide |
| SMILES | O=C(Cn1nnc2ccccc2c1=O)NCCCN1CCCCC1 |
| InChI | InChI=1S/C17H23N5O2/c23-16(18-9-6-12-21-10-4-1-5-11-21)13-22-17(24)14-7-2-3-8-15(14)19-20-22/h2-3,7-8H,1,4-6,9-13H2,(H,18,23) |
| InChIKey | BIZUWAWJBMUQIK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|