C19H16BrNO2 — CID 20896589
7-bromo-N-(2-phenylethyl)-1-benzoxepine-4-carboxamide (PubChem CID 20896589) has the molecular formula C19H16BrNO2 and a molecular weight of 370.25 g/mol. Its IUPAC name is 7-bromo-N-(2-phenylethyl)-1-benzoxepine-4-carboxamide.
| Compound Name | 7-bromo-N-(2-phenylethyl)-1-benzoxepine-4-carboxamide |
|---|---|
| PubChem CID | 20896589 |
| Molecular Formula | C19H16BrNO2 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 7-bromo-N-(2-phenylethyl)-1-benzoxepine-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1=Cc2cc(Br)ccc2OC=C1 |
| InChI | InChI=1S/C19H16BrNO2/c20-17-6-7-18-16(13-17)12-15(9-11-23-18)19(22)21-10-8-14-4-2-1-3-5-14/h1-7,9,11-13H,8,10H2,(H,21,22) |
| InChIKey | PYIOOFGGNMAAOF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |