C28H31N3O2 — CID 20905633
N-[4-(diethylamino)-2-methylphenyl]-2-(3-oxo-1H-isoindol-2-yl)-3-phenylpropanamide (PubChem CID 20905633) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-(3-oxo-1H-isoindol-2-yl)-3-phenylpropanamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-(3-oxo-1H-isoindol-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 20905633 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-(3-oxo-1H-isoindol-2-yl)-3-phenylpropanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(Cc2ccccc2)N2Cc3ccccc3C2=O)c(C)c1 |
| InChI | InChI=1S/C28H31N3O2/c1-4-30(5-2)23-15-16-25(20(3)17-23)29-27(32)26(18-21-11-7-6-8-12-21)31-19-22-13-9-10-14-24(22)28(31)33/h6-17,26H,4-5,18-19H2,1-3H3,(H,29,32) |
| InChIKey | LPCFKBYRERRWEW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|