C22H26BrN3O3 — CID 20908059
1-(1-acetylpiperidin-4-yl)-3-(3-bromophenyl)-1-[(4-methoxyphenyl)methyl]urea (PubChem CID 20908059) has the molecular formula C22H26BrN3O3 and a molecular weight of 460.37 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-(3-bromophenyl)-1-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-(3-bromophenyl)-1-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 20908059 |
| Molecular Formula | C22H26BrN3O3 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-(3-bromophenyl)-1-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CN(C(=O)Nc2cccc(Br)c2)C2CCN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C22H26BrN3O3/c1-16(27)25-12-10-20(11-13-25)26(15-17-6-8-21(29-2)9-7-17)22(28)24-19-5-3-4-18(23)14-19/h3-9,14,20H,10-13,15H2,1-2H3,(H,24,28) |
| InChIKey | MYOSZKFKLQFROC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |