C22H26N2O4 — CID 125164540
3-(3-acetylphenyl)-1-[(4-methoxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 125164540) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-(3-acetylphenyl)-1-[(4-methoxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 3-(3-acetylphenyl)-1-[(4-methoxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 125164540 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-(3-acetylphenyl)-1-[(4-methoxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | COc1ccc(CN(C[C@H]2CCCO2)C(=O)Nc2cccc(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-16(25)18-5-3-6-19(13-18)23-22(26)24(15-21-7-4-12-28-21)14-17-8-10-20(27-2)11-9-17/h3,5-6,8-11,13,21H,4,7,12,14-15H2,1-2H3,(H,23,26)/t21-/m1/s1 |
| InChIKey | BHKGBTLVJIAWEE-OAQYLSRUSA-N |
| XLogP | 4.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |