About 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea
3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea (PubChem CID 20908264) has the molecular formula C23H30FN3O3
and a molecular weight of 415.51 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea.
Molecular Properties
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea |
| PubChem CID | 20908264 |
| Molecular Formula | C23H30FN3O3 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea |
| SMILES | CCN1CCC(N(Cc2ccc(F)cc2)C(=O)Nc2ccc(OC)cc2OC)CC1 |
| InChI | InChI=1S/C23H30FN3O3/c1-4-26-13-11-19(12-14-26)27(16-17-5-7-18(24)8-6-17)23(28)25-21-10-9-20(29-2)15-22(21)30-3/h5-10,15,19H,4,11-14,16H2,1-3H3,(H,25,28) |
| InChIKey | RQDQTIKKECREBE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea?
The IUPAC name of 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea (CID 20908264) is 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea.
What is the SMILES notation for 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea?
The canonical SMILES for 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea is CCN1CCC(N(Cc2ccc(F)cc2)C(=O)Nc2ccc(OC)cc2OC)CC1.
What is the InChIKey of 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea?
The InChIKey is RQDQTIKKECREBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30FN3O3/c1-4-26-13-11-19(12-14-26)27(16-17-5-7-18(24)8-6-17)23(28)25-21-10-9-20(29-2)15-22(21)30-3/h5-10,15,19H,4,11-14,16H2,1-3H3,(H,25,28).
What are the key properties of 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea?
3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea has a molecular weight of 415.51 g/mol, XLogP of 4.36, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxyphenyl)-1-(1-ethylpiperidin-4-yl)-1-[(4-fluorophenyl)methyl]urea is sourced from PubChem (CID 20908264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).