C16H11BrN2O3S — CID 2090828
[2-(2-bromoanilino)-2-oxoethyl] 1,3-benzothiazole-6-carboxylate (PubChem CID 2090828) has the molecular formula C16H11BrN2O3S and a molecular weight of 391.25 g/mol. Its IUPAC name is [2-(2-bromoanilino)-2-oxoethyl] 1,3-benzothiazole-6-carboxylate.
| Compound Name | [2-(2-bromoanilino)-2-oxoethyl] 1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 2090828 |
| Molecular Formula | C16H11BrN2O3S |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | [2-(2-bromoanilino)-2-oxoethyl] 1,3-benzothiazole-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2ncsc2c1)Nc1ccccc1Br |
| InChI | InChI=1S/C16H11BrN2O3S/c17-11-3-1-2-4-12(11)19-15(20)8-22-16(21)10-5-6-13-14(7-10)23-9-18-13/h1-7,9H,8H2,(H,19,20) |
| InChIKey | PLSNQIPNZAOEKX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |