C19H17FN4O3 — CID 20910914
(2-fluorophenyl)-[4-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]piperazin-1-yl]methanone (PubChem CID 20910914) has the molecular formula C19H17FN4O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is (2-fluorophenyl)-[4-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]piperazin-1-yl]methanone.
| Compound Name | (2-fluorophenyl)-[4-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 20910914 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (2-fluorophenyl)-[4-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(-c2ccco2)[nH]n1)N1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H17FN4O3/c20-14-5-2-1-4-13(14)18(25)23-7-9-24(10-8-23)19(26)16-12-15(21-22-16)17-6-3-11-27-17/h1-6,11-12H,7-10H2,(H,21,22) |
| InChIKey | PXIMLRMKTKGPNQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |