C19H26F3N3O3S — CID 20911382
1-(4-methylpiperidin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide (PubChem CID 20911382) has the molecular formula C19H26F3N3O3S and a molecular weight of 433.50 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-methylpiperidin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 20911382 |
| Molecular Formula | C19H26F3N3O3S |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide |
| SMILES | CC1CCN(S(=O)(=O)N2CCCC(C(=O)Nc3cccc(C(F)(F)F)c3)C2)CC1 |
| InChI | InChI=1S/C19H26F3N3O3S/c1-14-7-10-24(11-8-14)29(27,28)25-9-3-4-15(13-25)18(26)23-17-6-2-5-16(12-17)19(20,21)22/h2,5-6,12,14-15H,3-4,7-11,13H2,1H3,(H,23,26) |
| InChIKey | WLJIRNOKKDWBSL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |