C23H37N7O — CID 20912242
N-[3-(diethylamino)propyl]-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide (PubChem CID 20912242) has the molecular formula C23H37N7O and a molecular weight of 427.60 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 20912242 |
| Molecular Formula | C23H37N7O |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CCCN(c2ncnc3c2nc2n3CCCCC2)C1 |
| InChI | InChI=1S/C23H37N7O/c1-3-28(4-2)13-9-12-24-23(31)18-10-8-14-29(16-18)21-20-22(26-17-25-21)30-15-7-5-6-11-19(30)27-20/h17-18H,3-16H2,1-2H3,(H,24,31) |
| InChIKey | CUVYIXCDMMEDJY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|