C23H30ClN7 — CID 20912647
N-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine (PubChem CID 20912647) has the molecular formula C23H30ClN7 and a molecular weight of 440.00 g/mol. Its IUPAC name is N-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine.
| Compound Name | N-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine |
|---|---|
| PubChem CID | 20912647 |
| Molecular Formula | C23H30ClN7 |
| Molecular Weight | 440.00 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine |
| SMILES | Cc1ccc(Cl)cc1N1CCN(CCCNc2ncnc3c2nc2n3CCCC2)CC1 |
| InChI | InChI=1S/C23H30ClN7/c1-17-6-7-18(24)15-19(17)30-13-11-29(12-14-30)9-4-8-25-22-21-23(27-16-26-22)31-10-3-2-5-20(31)28-21/h6-7,15-16H,2-5,8-14H2,1H3,(H,25,26,27) |
| InChIKey | KYLLHVWFZFXFIC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.00 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|