C16H16F3N3OS — CID 20913742
N-(2-ethyl-6-methylphenyl)-2-methylsulfanyl-4-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 20913742) has the molecular formula C16H16F3N3OS and a molecular weight of 355.39 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-2-methylsulfanyl-4-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-2-methylsulfanyl-4-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 20913742 |
| Molecular Formula | C16H16F3N3OS |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-2-methylsulfanyl-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | CCc1cccc(C)c1NC(=O)c1cnc(SC)nc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3N3OS/c1-4-10-7-5-6-9(2)12(10)21-14(23)11-8-20-15(24-3)22-13(11)16(17,18)19/h5-8H,4H2,1-3H3,(H,21,23) |
| InChIKey | QQKFPJPELFZVDM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |