C14H11BrF3N3OS — CID 20913741
N-(4-bromo-3-methylphenyl)-2-methylsulfanyl-4-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 20913741) has the molecular formula C14H11BrF3N3OS and a molecular weight of 406.23 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-methylsulfanyl-4-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-methylsulfanyl-4-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 20913741 |
| Molecular Formula | C14H11BrF3N3OS |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-methylsulfanyl-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(=O)Nc2ccc(Br)c(C)c2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H11BrF3N3OS/c1-7-5-8(3-4-10(7)15)20-12(22)9-6-19-13(23-2)21-11(9)14(16,17)18/h3-6H,1-2H3,(H,20,22) |
| InChIKey | QUTGIMQEJPTAKJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |