C30H31N3O3 — CID 20916620
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-[5-methyl-4-(phenoxymethyl)-1,3-oxazol-2-yl]benzamide (PubChem CID 20916620) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-[5-methyl-4-(phenoxymethyl)-1,3-oxazol-2-yl]benzamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-[5-methyl-4-(phenoxymethyl)-1,3-oxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 20916620 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-[5-methyl-4-(phenoxymethyl)-1,3-oxazol-2-yl]benzamide |
| SMILES | Cc1oc(-c2ccc(C(=O)NCCCN3CCc4ccccc4C3)cc2)nc1COc1ccccc1 |
| InChI | InChI=1S/C30H31N3O3/c1-22-28(21-35-27-10-3-2-4-11-27)32-30(36-22)25-14-12-24(13-15-25)29(34)31-17-7-18-33-19-16-23-8-5-6-9-26(23)20-33/h2-6,8-15H,7,16-21H2,1H3,(H,31,34) |
| InChIKey | BZPXBSCBZIUUCB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|