C27H18N4O8 — CID 20918643
5-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-7-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-[1,3]dioxolo[4,5-g]quinazoline-6,8-dione (PubChem CID 20918643) has the molecular formula C27H18N4O8 and a molecular weight of 526.46 g/mol. Its IUPAC name is 5-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-7-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-[1,3]dioxolo[4,5-g]quinazoline-6,8-dione.
| Compound Name | 5-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-7-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-[1,3]dioxolo[4,5-g]quinazoline-6,8-dione |
|---|---|
| PubChem CID | 20918643 |
| Molecular Formula | C27H18N4O8 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | 5-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-7-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-[1,3]dioxolo[4,5-g]quinazoline-6,8-dione |
| SMILES | O=C(Cn1c(=O)n(Cc2nc(-c3ccccc3)no2)c(=O)c2cc3c(cc21)OCO3)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H18N4O8/c32-19(16-6-7-20-21(8-16)36-13-35-20)11-30-18-10-23-22(37-14-38-23)9-17(18)26(33)31(27(30)34)12-24-28-25(29-39-24)15-4-2-1-3-5-15/h1-10H,11-14H2 |
| InChIKey | KFYYHKIYZOAQQT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 136.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |