C24H23N5O6 — CID 52910827
N-(2,3-dimethylphenyl)-2-[7-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-6,8-dioxo-[1,3]dioxolo[4,5-g]quinazolin-5-yl]acetamide (PubChem CID 52910827) has the molecular formula C24H23N5O6 and a molecular weight of 477.48 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[7-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-6,8-dioxo-[1,3]dioxolo[4,5-g]quinazolin-5-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[7-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-6,8-dioxo-[1,3]dioxolo[4,5-g]quinazolin-5-yl]acetamide |
|---|---|
| PubChem CID | 52910827 |
| Molecular Formula | C24H23N5O6 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[7-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-6,8-dioxo-[1,3]dioxolo[4,5-g]quinazolin-5-yl]acetamide |
| SMILES | Cc1noc(CCn2c(=O)c3cc4c(cc3n(CC(=O)Nc3cccc(C)c3C)c2=O)OCO4)n1 |
| InChI | InChI=1S/C24H23N5O6/c1-13-5-4-6-17(14(13)2)26-21(30)11-29-18-10-20-19(33-12-34-20)9-16(18)23(31)28(24(29)32)8-7-22-25-15(3)27-35-22/h4-6,9-10H,7-8,11-12H2,1-3H3,(H,26,30) |
| InChIKey | WFJSQYDKPZMEIG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |