C25H25N5O6 — CID 52910840
N-(2,5-dimethylphenyl)-2-[7-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-6,8-dioxo-[1,3]dioxolo[4,5-g]quinazolin-5-yl]acetamide (PubChem CID 52910840) has the molecular formula C25H25N5O6 and a molecular weight of 491.50 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[7-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-6,8-dioxo-[1,3]dioxolo[4,5-g]quinazolin-5-yl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[7-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-6,8-dioxo-[1,3]dioxolo[4,5-g]quinazolin-5-yl]acetamide |
|---|---|
| PubChem CID | 52910840 |
| Molecular Formula | C25H25N5O6 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[7-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-6,8-dioxo-[1,3]dioxolo[4,5-g]quinazolin-5-yl]acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)Cn2c(=O)n(CCCc3nc(C)no3)c(=O)c3cc4c(cc32)OCO4)c1 |
| InChI | InChI=1S/C25H25N5O6/c1-14-6-7-15(2)18(9-14)27-22(31)12-30-19-11-21-20(34-13-35-21)10-17(19)24(32)29(25(30)33)8-4-5-23-26-16(3)28-36-23/h6-7,9-11H,4-5,8,12-13H2,1-3H3,(H,27,31) |
| InChIKey | KGCCZFVGHVHDSL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |