C19H19FN4O — CID 20919334
N-[(4-fluorophenyl)methyl]-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5,7-tetraene-5-carboxamide (PubChem CID 20919334) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5,7-tetraene-5-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5,7-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 20919334 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5,7-tetraene-5-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cnn2c3c(cnc12)CCCCC3 |
| InChI | InChI=1S/C19H19FN4O/c20-15-8-6-13(7-9-15)10-22-19(25)16-12-23-24-17-5-3-1-2-4-14(17)11-21-18(16)24/h6-9,11-12H,1-5,10H2,(H,22,25) |
| InChIKey | OKLYPNZRUZSPIQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |