C17H18N4O2 — CID 20919312
N-(furan-2-ylmethyl)-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5,7-tetraene-5-carboxamide (PubChem CID 20919312) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5,7-tetraene-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5,7-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 20919312 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5,7-tetraene-5-carboxamide |
| SMILES | O=C(NCc1ccco1)c1cnn2c3c(cnc12)CCCCC3 |
| InChI | InChI=1S/C17H18N4O2/c22-17(19-10-13-6-4-8-23-13)14-11-20-21-15-7-3-1-2-5-12(15)9-18-16(14)21/h4,6,8-9,11H,1-3,5,7,10H2,(H,19,22) |
| InChIKey | RIJDZURUWRNYJG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |