C18H24N4O — CID 20919360
N-cyclopentyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide (PubChem CID 20919360) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-cyclopentyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide.
| Compound Name | N-cyclopentyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 20919360 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-cyclopentyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cnn2c3c(cnc12)CCCCCC3 |
| InChI | InChI=1S/C18H24N4O/c23-18(21-14-8-5-6-9-14)15-12-20-22-16-10-4-2-1-3-7-13(16)11-19-17(15)22/h11-12,14H,1-10H2,(H,21,23) |
| InChIKey | PMTMQSFAFMKLOM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |