C29H34N6O2 — CID 20920448
1-[2-(4-methoxyphenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide (PubChem CID 20920448) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide.
| Compound Name | 1-[2-(4-methoxyphenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 20920448 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(-n2nc3c(N4CCCC(C(=O)NCCCc5ccccc5)C4)nnc(C)c3c2C)cc1 |
| InChI | InChI=1S/C29H34N6O2/c1-20-26-21(2)35(24-13-15-25(37-3)16-14-24)33-27(26)28(32-31-20)34-18-8-12-23(19-34)29(36)30-17-7-11-22-9-5-4-6-10-22/h4-6,9-10,13-16,23H,7-8,11-12,17-19H2,1-3H3,(H,30,36) |
| InChIKey | XKIGPPVIRLTKGG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|