C22H28N6O2 — CID 92691840
(3R)-1-(3,4-dimethyl-2-phenylpyrazolo[3,4-d]pyridazin-7-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 92691840) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is (3R)-1-(3,4-dimethyl-2-phenylpyrazolo[3,4-d]pyridazin-7-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(3,4-dimethyl-2-phenylpyrazolo[3,4-d]pyridazin-7-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92691840 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (3R)-1-(3,4-dimethyl-2-phenylpyrazolo[3,4-d]pyridazin-7-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CCCN(c2nnc(C)c3c(C)n(-c4ccccc4)nc23)C1 |
| InChI | InChI=1S/C22H28N6O2/c1-15-19-16(2)28(18-9-5-4-6-10-18)26-20(19)21(25-24-15)27-12-7-8-17(14-27)22(29)23-11-13-30-3/h4-6,9-10,17H,7-8,11-14H2,1-3H3,(H,23,29)/t17-/m1/s1 |
| InChIKey | MTIIZVBWWUKICJ-QGZVFWFLSA-N |
| XLogP | 2.41 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|