C19H15ClFNO2 — CID 20921740
3-(3-chloro-4-fluoroanilino)-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 20921740) has the molecular formula C19H15ClFNO2 and a molecular weight of 343.79 g/mol. Its IUPAC name is 3-(3-chloro-4-fluoroanilino)-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3-chloro-4-fluoroanilino)-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20921740 |
| Molecular Formula | C19H15ClFNO2 |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 3-(3-chloro-4-fluoroanilino)-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1cc(C)c(-c2c(Nc3ccc(F)c(Cl)c3)c(=O)c2=O)cc1C |
| InChI | InChI=1S/C19H15ClFNO2/c1-9-6-11(3)13(7-10(9)2)16-17(19(24)18(16)23)22-12-4-5-15(21)14(20)8-12/h4-8,22H,1-3H3 |
| InChIKey | PQSUHSDXVNBXNH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|