C12H12ClFN4O2 — CID 60662415
6-amino-5-(3-chloro-4-fluoroanilino)-1-ethylpyrimidine-2,4-dione (PubChem CID 60662415) has the molecular formula C12H12ClFN4O2 and a molecular weight of 298.71 g/mol. Its IUPAC name is 6-amino-5-(3-chloro-4-fluoroanilino)-1-ethylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-(3-chloro-4-fluoroanilino)-1-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60662415 |
| Molecular Formula | C12H12ClFN4O2 |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 6-amino-5-(3-chloro-4-fluoroanilino)-1-ethylpyrimidine-2,4-dione |
| SMILES | CCn1c(N)c(Nc2ccc(F)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H12ClFN4O2/c1-2-18-10(15)9(11(19)17-12(18)20)16-6-3-4-8(14)7(13)5-6/h3-5,16H,2,15H2,1H3,(H,17,19,20) |
| InChIKey | HLZXGDOAVPGFAK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |