C16H22N4O5S2 — CID 20921844
N-benzyl-2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-methylacetamide (PubChem CID 20921844) has the molecular formula C16H22N4O5S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-benzyl-2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-methylacetamide.
| Compound Name | N-benzyl-2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 20921844 |
| Molecular Formula | C16H22N4O5S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-benzyl-2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-methylacetamide |
| SMILES | CNS(=O)(=O)c1cn(CC(=O)N(C)Cc2ccccc2)cc1S(=O)(=O)NC |
| InChI | InChI=1S/C16H22N4O5S2/c1-17-26(22,23)14-10-20(11-15(14)27(24,25)18-2)12-16(21)19(3)9-13-7-5-4-6-8-13/h4-8,10-11,17-18H,9,12H2,1-3H3 |
| InChIKey | NGNCYZUWZABZKW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |