C14H18N4O5S2 — CID 20921912
2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-phenylacetamide (PubChem CID 20921912) has the molecular formula C14H18N4O5S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-phenylacetamide.
| Compound Name | 2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 20921912 |
| Molecular Formula | C14H18N4O5S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-phenylacetamide |
| SMILES | CNS(=O)(=O)c1cn(CC(=O)Nc2ccccc2)cc1S(=O)(=O)NC |
| InChI | InChI=1S/C14H18N4O5S2/c1-15-24(20,21)12-8-18(9-13(12)25(22,23)16-2)10-14(19)17-11-6-4-3-5-7-11/h3-9,15-16H,10H2,1-2H3,(H,17,19) |
| InChIKey | GLTBRULEFUYZDD-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |