C16H22N4O5S2 — CID 20921852
2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 20921852) has the molecular formula C16H22N4O5S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 20921852 |
| Molecular Formula | C16H22N4O5S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | CNS(=O)(=O)c1cn(CC(=O)Nc2cccc(C)c2C)cc1S(=O)(=O)NC |
| InChI | InChI=1S/C16H22N4O5S2/c1-11-6-5-7-13(12(11)2)19-16(21)10-20-8-14(26(22,23)17-3)15(9-20)27(24,25)18-4/h5-9,17-18H,10H2,1-4H3,(H,19,21) |
| InChIKey | QWMNUONCRSSPLL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |