C26H22F3N3O2 — CID 20921998
2-[3-(anilinomethyl)-7-methyl-2-oxoquinolin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 20921998) has the molecular formula C26H22F3N3O2 and a molecular weight of 465.48 g/mol. Its IUPAC name is 2-[3-(anilinomethyl)-7-methyl-2-oxoquinolin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[3-(anilinomethyl)-7-methyl-2-oxoquinolin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 20921998 |
| Molecular Formula | C26H22F3N3O2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-[3-(anilinomethyl)-7-methyl-2-oxoquinolin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc2cc(CNc3ccccc3)c(=O)n(CC(=O)Nc3ccccc3C(F)(F)F)c2c1 |
| InChI | InChI=1S/C26H22F3N3O2/c1-17-11-12-18-14-19(15-30-20-7-3-2-4-8-20)25(34)32(23(18)13-17)16-24(33)31-22-10-6-5-9-21(22)26(27,28)29/h2-14,30H,15-16H2,1H3,(H,31,33) |
| InChIKey | ZTPPLLANMUGTNN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |