C21H19F3N4O3 — CID 53097799
2-[3-[acetyl(ethyl)amino]-2-oxoquinoxalin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 53097799) has the molecular formula C21H19F3N4O3 and a molecular weight of 432.40 g/mol. Its IUPAC name is 2-[3-[acetyl(ethyl)amino]-2-oxoquinoxalin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[3-[acetyl(ethyl)amino]-2-oxoquinoxalin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 53097799 |
| Molecular Formula | C21H19F3N4O3 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-[3-[acetyl(ethyl)amino]-2-oxoquinoxalin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN(C(C)=O)c1nc2ccccc2n(CC(=O)Nc2ccccc2C(F)(F)F)c1=O |
| InChI | InChI=1S/C21H19F3N4O3/c1-3-27(13(2)29)19-20(31)28(17-11-7-6-10-16(17)26-19)12-18(30)25-15-9-5-4-8-14(15)21(22,23)24/h4-11H,3,12H2,1-2H3,(H,25,30) |
| InChIKey | MTGJNBSUTSLZOJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |