C25H28N4O4 — CID 53097850
2-[3-[acetyl(cyclohexyl)amino]-2-oxoquinoxalin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 53097850) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[3-[acetyl(cyclohexyl)amino]-2-oxoquinoxalin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[3-[acetyl(cyclohexyl)amino]-2-oxoquinoxalin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 53097850 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-[3-[acetyl(cyclohexyl)amino]-2-oxoquinoxalin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)Cn1c(=O)c(N(C(C)=O)C2CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C25H28N4O4/c1-17(30)29(18-10-4-3-5-11-18)24-25(32)28(21-14-8-6-12-19(21)27-24)16-23(31)26-20-13-7-9-15-22(20)33-2/h6-9,12-15,18H,3-5,10-11,16H2,1-2H3,(H,26,31) |
| InChIKey | KUGQRCOSYMSGFQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |