C24H31N5O5 — CID 20922933
1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]piperidine-4-carboxamide (PubChem CID 20922933) has the molecular formula C24H31N5O5 and a molecular weight of 469.54 g/mol. Its IUPAC name is 1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20922933 |
| Molecular Formula | C24H31N5O5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(-c2noc(CN3CCC(C(=O)NCCc4c(C)noc4C)CC3)n2)cc1OC |
| InChI | InChI=1S/C24H31N5O5/c1-15-19(16(2)33-27-15)7-10-25-24(30)17-8-11-29(12-9-17)14-22-26-23(28-34-22)18-5-6-20(31-3)21(13-18)32-4/h5-6,13,17H,7-12,14H2,1-4H3,(H,25,30) |
| InChIKey | CONLJFZGLKQXAW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 115.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |