C26H39N5O4 — CID 20922951
N-[3-(azepan-1-yl)propyl]-1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide (PubChem CID 20922951) has the molecular formula C26H39N5O4 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20922951 |
| Molecular Formula | C26H39N5O4 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(-c2noc(CN3CCC(C(=O)NCCCN4CCCCCC4)CC3)n2)cc1OC |
| InChI | InChI=1S/C26H39N5O4/c1-33-22-9-8-21(18-23(22)34-2)25-28-24(35-29-25)19-31-16-10-20(11-17-31)26(32)27-12-7-15-30-13-5-3-4-6-14-30/h8-9,18,20H,3-7,10-17,19H2,1-2H3,(H,27,32) |
| InChIKey | PLKPHKOMPAEUBA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|