C22H26N2O4S2 — CID 20923216
2-methyl-3-[(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]-N-(3-phenylpropyl)propanamide (PubChem CID 20923216) has the molecular formula C22H26N2O4S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2-methyl-3-[(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]-N-(3-phenylpropyl)propanamide.
| Compound Name | 2-methyl-3-[(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 20923216 |
| Molecular Formula | C22H26N2O4S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-methyl-3-[(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]-N-(3-phenylpropyl)propanamide |
| SMILES | CC(CS(=O)(=O)c1ccc2c(c1)NC(=O)C(C)S2)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O4S2/c1-15(21(25)23-12-6-9-17-7-4-3-5-8-17)14-30(27,28)18-10-11-20-19(13-18)24-22(26)16(2)29-20/h3-5,7-8,10-11,13,15-16H,6,9,12,14H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | MWNQOSWUQAXNNI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|