C24H23ClN2O2 — CID 20926844
3-[4-(3-chlorophenyl)piperazin-1-yl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)cyclobut-3-ene-1,2-dione (PubChem CID 20926844) has the molecular formula C24H23ClN2O2 and a molecular weight of 406.91 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-yl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20926844 |
| Molecular Formula | C24H23ClN2O2 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(-c2ccc3c(c2)CCCC3)c(N2CCN(c3cccc(Cl)c3)CC2)c1=O |
| InChI | InChI=1S/C24H23ClN2O2/c25-19-6-3-7-20(15-19)26-10-12-27(13-11-26)22-21(23(28)24(22)29)18-9-8-16-4-1-2-5-17(16)14-18/h3,6-9,14-15H,1-2,4-5,10-13H2 |
| InChIKey | QLMKPXDNMIZIEE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|