C21H32N2O — CID 20930657
4-[(4-methylcyclohexyl)methyl]-N-(4-methylphenyl)piperidine-1-carboxamide (PubChem CID 20930657) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is 4-[(4-methylcyclohexyl)methyl]-N-(4-methylphenyl)piperidine-1-carboxamide.
| Compound Name | 4-[(4-methylcyclohexyl)methyl]-N-(4-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 20930657 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 4-[(4-methylcyclohexyl)methyl]-N-(4-methylphenyl)piperidine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCC(CC3CCC(C)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H32N2O/c1-16-3-7-18(8-4-16)15-19-11-13-23(14-12-19)21(24)22-20-9-5-17(2)6-10-20/h5-6,9-10,16,18-19H,3-4,7-8,11-15H2,1-2H3,(H,22,24) |
| InChIKey | BSXVEXLHCMPMRM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |