C23H22FN3O2S2 — CID 20933265
N-[(4-butoxyphenyl)methyl]-2-[(9-fluoro-[1]benzothiolo[3,2-d]pyrimidin-4-yl)sulfanyl]acetamide (PubChem CID 20933265) has the molecular formula C23H22FN3O2S2 and a molecular weight of 455.58 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-2-[(9-fluoro-[1]benzothiolo[3,2-d]pyrimidin-4-yl)sulfanyl]acetamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-2-[(9-fluoro-[1]benzothiolo[3,2-d]pyrimidin-4-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 20933265 |
| Molecular Formula | C23H22FN3O2S2 |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-2-[(9-fluoro-[1]benzothiolo[3,2-d]pyrimidin-4-yl)sulfanyl]acetamide |
| SMILES | CCCCOc1ccc(CNC(=O)CSc2ncnc3c2sc2cccc(F)c23)cc1 |
| InChI | InChI=1S/C23H22FN3O2S2/c1-2-3-11-29-16-9-7-15(8-10-16)12-25-19(28)13-30-23-22-21(26-14-27-23)20-17(24)5-4-6-18(20)31-22/h4-10,14H,2-3,11-13H2,1H3,(H,25,28) |
| InChIKey | DSKJHEBRNGEUSV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|