C22H23ClN2O3S2 — CID 20934648
N-(4-chlorophenyl)-N-[[4-(morpholin-4-ylmethyl)thiophen-2-yl]methyl]benzenesulfonamide (PubChem CID 20934648) has the molecular formula C22H23ClN2O3S2 and a molecular weight of 463.02 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-[[4-(morpholin-4-ylmethyl)thiophen-2-yl]methyl]benzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-N-[[4-(morpholin-4-ylmethyl)thiophen-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20934648 |
| Molecular Formula | C22H23ClN2O3S2 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-(4-chlorophenyl)-N-[[4-(morpholin-4-ylmethyl)thiophen-2-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(Cc1cc(CN2CCOCC2)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN2O3S2/c23-19-6-8-20(9-7-19)25(30(26,27)22-4-2-1-3-5-22)16-21-14-18(17-29-21)15-24-10-12-28-13-11-24/h1-9,14,17H,10-13,15-16H2 |
| InChIKey | XJSLRXOZJCSQHF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |