C12H13F3N2O4S2 — CID 20935956
N-(3-methoxypropyl)-5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-2-sulfonamide (PubChem CID 20935956) has the molecular formula C12H13F3N2O4S2 and a molecular weight of 370.37 g/mol. Its IUPAC name is N-(3-methoxypropyl)-5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-(3-methoxypropyl)-5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20935956 |
| Molecular Formula | C12H13F3N2O4S2 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | N-(3-methoxypropyl)-5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-2-sulfonamide |
| SMILES | COCCCNS(=O)(=O)c1ccc(-c2cc(C(F)(F)F)on2)s1 |
| InChI | InChI=1S/C12H13F3N2O4S2/c1-20-6-2-5-16-23(18,19)11-4-3-9(22-11)8-7-10(21-17-8)12(13,14)15/h3-4,7,16H,2,5-6H2,1H3 |
| InChIKey | JMEBHGHTPFILHS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|