C18H21F3N2O3S2 — CID 6977648
5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]thiophene-2-sulfonamide (PubChem CID 6977648) has the molecular formula C18H21F3N2O3S2 and a molecular weight of 434.51 g/mol. Its IUPAC name is 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]thiophene-2-sulfonamide.
| Compound Name | 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 6977648 |
| Molecular Formula | C18H21F3N2O3S2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]thiophene-2-sulfonamide |
| SMILES | CC1(C)[C@@H]2CC[C@@](C)(C2)[C@@H]1NS(=O)(=O)c1ccc(-c2cc(C(F)(F)F)on2)s1 |
| InChI | InChI=1S/C18H21F3N2O3S2/c1-16(2)10-6-7-17(3,9-10)15(16)23-28(24,25)14-5-4-12(27-14)11-8-13(26-22-11)18(19,20)21/h4-5,8,10,15,23H,6-7,9H2,1-3H3/t10-,15-,17+/m1/s1 |
| InChIKey | DUALNALUQKUVMH-FNDUUJAJSA-N |
| XLogP | 4.91 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |