C24H32N4O3S2 — CID 20936067
N-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide (PubChem CID 20936067) has the molecular formula C24H32N4O3S2 and a molecular weight of 488.68 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide |
|---|---|
| PubChem CID | 20936067 |
| Molecular Formula | C24H32N4O3S2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-3-methyl-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide |
| SMILES | CC1CSc2ccc(S(=O)(=O)NCCCN3CCN(Cc4ccccc4)CC3)cc2NC1=O |
| InChI | InChI=1S/C24H32N4O3S2/c1-19-18-32-23-9-8-21(16-22(23)26-24(19)29)33(30,31)25-10-5-11-27-12-14-28(15-13-27)17-20-6-3-2-4-7-20/h2-4,6-9,16,19,25H,5,10-15,17-18H2,1H3,(H,26,29) |
| InChIKey | GPBRMLHDIYWJCP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|