C22H25N3O5S — CID 20936706
2-[3-(4-ethoxyphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 20936706) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-[3-(4-ethoxyphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[3-(4-ethoxyphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 20936706 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-[3-(4-ethoxyphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | CCOc1ccc(N2C(=O)N(CC(=O)Nc3cccc(C)c3)C3CS(=O)(=O)CC32)cc1 |
| InChI | InChI=1S/C22H25N3O5S/c1-3-30-18-9-7-17(8-10-18)25-20-14-31(28,29)13-19(20)24(22(25)27)12-21(26)23-16-6-4-5-15(2)11-16/h4-11,19-20H,3,12-14H2,1-2H3,(H,23,26) |
| InChIKey | DSCBFTYHSCOIAJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|