C18H15NO3S — CID 20937719
methyl 2-benzylsulfanyl-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 20937719) has the molecular formula C18H15NO3S and a molecular weight of 325.39 g/mol. Its IUPAC name is methyl 2-benzylsulfanyl-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | methyl 2-benzylsulfanyl-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 20937719 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | methyl 2-benzylsulfanyl-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | COC(=O)c1c(SCc2ccccc2)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C18H15NO3S/c1-22-18(21)15-16(20)13-9-5-6-10-14(13)19-17(15)23-11-12-7-3-2-4-8-12/h2-10H,11H2,1H3,(H,19,20) |
| InChIKey | XPIPRJILSJJQJZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |