C23H19NO4S — CID 14437284
dimethyl 4-benzylsulfanyl-9H-carbazole-1,2-dicarboxylate (PubChem CID 14437284) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is dimethyl 4-benzylsulfanyl-9H-carbazole-1,2-dicarboxylate.
| Compound Name | dimethyl 4-benzylsulfanyl-9H-carbazole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 14437284 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | dimethyl 4-benzylsulfanyl-9H-carbazole-1,2-dicarboxylate |
| SMILES | COC(=O)c1cc(SCc2ccccc2)c2c([nH]c3ccccc32)c1C(=O)OC |
| InChI | InChI=1S/C23H19NO4S/c1-27-22(25)16-12-18(29-13-14-8-4-3-5-9-14)19-15-10-6-7-11-17(15)24-21(19)20(16)23(26)28-2/h3-12,24H,13H2,1-2H3 |
| InChIKey | JFAYNUWRBUZMPQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |