C19H20N6OS2 — CID 20939035
2-butyl-7-[[5-(2-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 20939035) has the molecular formula C19H20N6OS2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 2-butyl-7-[[5-(2-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-butyl-7-[[5-(2-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 20939035 |
| Molecular Formula | C19H20N6OS2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-butyl-7-[[5-(2-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCCc1nn2c(=O)cc(CSc3n[nH]c(-c4ccccc4C)n3)nc2s1 |
| InChI | InChI=1S/C19H20N6OS2/c1-3-4-9-15-24-25-16(26)10-13(20-19(25)28-15)11-27-18-21-17(22-23-18)14-8-6-5-7-12(14)2/h5-8,10H,3-4,9,11H2,1-2H3,(H,21,22,23) |
| InChIKey | UHCAKAVEMJVYLD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |