C24H34N4OS — CID 20940455
N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-phenyl-5-piperidin-1-ylthiophene-2-carboxamide (PubChem CID 20940455) has the molecular formula C24H34N4OS and a molecular weight of 426.63 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-phenyl-5-piperidin-1-ylthiophene-2-carboxamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-phenyl-5-piperidin-1-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 20940455 |
| Molecular Formula | C24H34N4OS |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-phenyl-5-piperidin-1-ylthiophene-2-carboxamide |
| SMILES | CCN1CCN(CCNC(=O)c2cc(-c3ccccc3)c(N3CCCCC3)s2)CC1 |
| InChI | InChI=1S/C24H34N4OS/c1-2-26-15-17-27(18-16-26)14-11-25-23(29)22-19-21(20-9-5-3-6-10-20)24(30-22)28-12-7-4-8-13-28/h3,5-6,9-10,19H,2,4,7-8,11-18H2,1H3,(H,25,29) |
| InChIKey | ZEZBUSXOZQEJGD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |