C25H29N3O2S — CID 20940825
N-cyclohexyl-1-(5-indol-1-ylthiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 20940825) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is N-cyclohexyl-1-(5-indol-1-ylthiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-cyclohexyl-1-(5-indol-1-ylthiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20940825 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-cyclohexyl-1-(5-indol-1-ylthiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CCN(C(=O)c2ccc(-n3ccc4ccccc43)s2)CC1 |
| InChI | InChI=1S/C25H29N3O2S/c29-24(26-20-7-2-1-3-8-20)19-12-15-27(16-13-19)25(30)22-10-11-23(31-22)28-17-14-18-6-4-5-9-21(18)28/h4-6,9-11,14,17,19-20H,1-3,7-8,12-13,15-16H2,(H,26,29) |
| InChIKey | GIRLRCHHYNKZIL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |