C29H28N4O2S — CID 20940820
N-[2-(1H-indol-3-yl)ethyl]-1-(5-indol-1-ylthiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 20940820) has the molecular formula C29H28N4O2S and a molecular weight of 496.64 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-1-(5-indol-1-ylthiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-1-(5-indol-1-ylthiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20940820 |
| Molecular Formula | C29H28N4O2S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-1-(5-indol-1-ylthiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C1CCN(C(=O)c2ccc(-n3ccc4ccccc43)s2)CC1 |
| InChI | InChI=1S/C29H28N4O2S/c34-28(30-15-11-22-19-31-24-7-3-2-6-23(22)24)21-12-16-32(17-13-21)29(35)26-9-10-27(36-26)33-18-14-20-5-1-4-8-25(20)33/h1-10,14,18-19,21,31H,11-13,15-17H2,(H,30,34) |
| InChIKey | VJYJECCKACLFMS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |